Products 1226808-68-9

CAS 1226808-68-9 is the registry number for 3-Bromo-5-propoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-bromo-5-propoxybenzoic acid (CAS 1226808-68-9) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 3-bromo-5-propoxybenzoic acid. InChIKey: OFSWAAVHABKEGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO3
Molecular weight259.10 g/mol
IUPAC name3-bromo-5-propoxybenzoic acid
InChIKeyOFSWAAVHABKEGJ-UHFFFAOYSA-N
SMILESCCCOC1=CC(=CC(=C1)C(=O)O)Br

Computed by PubChem (NCBI)