CAS 1226808-68-9 is the registry number for 3-Bromo-5-propoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-bromo-5-propoxybenzoic acid (CAS 1226808-68-9) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 3-bromo-5-propoxybenzoic acid. InChIKey: OFSWAAVHABKEGJ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 3-bromo-5-propoxybenzoic acid |
| InChIKey | OFSWAAVHABKEGJ-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)