CAS 7472-69-7 appears in our catalog under these names: 2-(4-Bromophenoxy)-2-methylpropanoic acid, 98%, 2-(4-Bromophenoxy)-2-methylpropanoic acid 95%, 2-(4-Bromophenoxy)-2-methylpropanoic acid, 95%, 95%, 2-(4-bromophenoxy)-2-methylpropanoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
2-(4-bromophenoxy)-2-methylpropanoic acid (CAS 7472-69-7) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 2-(4-bromophenoxy)-2-methylpropanoic acid. InChIKey: NRDUHXQTTOHIJX-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2-(4-bromophenoxy)-2-methylpropanoic acid |
| InChIKey | NRDUHXQTTOHIJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)