cas: 135875-16-0 — see every product listed under this CAS number, including other names
2-(5-Chloro-1H-benzo[d]imidazol-2-yl)ethanamine 95% (CAS 135875-16-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A421216-100mg |
| cas | 135875-16-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1799.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A421216 |
2-(6-chloro-1H-benzimidazol-2-yl)ethanamine (CAS 135875-16-0) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine. InChIKey: WKDCEGOIWKEIGY-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine |
| InChIKey | WKDCEGOIWKEIGY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)CCN |
Computed by PubChem (NCBI)