CAS 1156753-55-7 appears in our catalog under these names: 5-Chloro-1-ethyl-1h-1,3-benzodiazol-2-amine, 95%, 5-chloro-1-ethyl-1H-1,3-benzodiazol-2-amine, 5-chloro-1-ethyl-1H-1,3-benzodiazol-2-amine, ≥95%, ≥95%, 5-Chloro-1-ethyl-1H-benzimidazol-2-amine, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg, 100mg.
5-chloro-1-ethylbenzimidazol-2-amine (CAS 1156753-55-7) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 5-chloro-1-ethylbenzimidazol-2-amine. InChIKey: IENZKHQOAZUDKM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 5-chloro-1-ethylbenzimidazol-2-amine |
| InChIKey | IENZKHQOAZUDKM-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Cl)N=C1N |
Computed by PubChem (NCBI)