cas: 135875-16-0 — see every product listed under this CAS number, including other names
[2-(5-chloro-1H-benzimidazol-2-yl)ethyl]amine, 95% (CAS 135875-16-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030509-100MG |
| cas | 135875-16-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 810.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(6-chloro-1H-benzimidazol-2-yl)ethanamine (CAS 135875-16-0) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine. InChIKey: WKDCEGOIWKEIGY-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine |
| InChIKey | WKDCEGOIWKEIGY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)CCN |
Computed by PubChem (NCBI)