cas: 1190129-77-1 — see every product listed under this CAS number, including other names
2-(5-Chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 1190129-77-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 50g, 100g, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111P2M-250mg |
| cas | 1190129-77-1 |
| size | 250mg |
| availability | 161.7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 50g | 1322.00 Pln | |
| Chemat | 100g | 2584.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 10g | 342.80 Pln | |
| Chemat | 25g | 693.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(5-chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1190129-77-1) is a chemical compound with the molecular formula C12H15BClFO2 and a molecular weight of 256.51 g/mol. IUPAC name: 2-(5-chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BFXSWDUFRGWPCA-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO2 |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 2-(5-chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BFXSWDUFRGWPCA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)F |
Computed by PubChem (NCBI)