cas: 383134-15-4 — see every product listed under this CAS number, including other names
2-(5-Chloro-2-methoxy-4-methylphenyl)acetic acid, 97% (CAS 383134-15-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A255619-25g |
| cas | 383134-15-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 11918.20 Pln | |
| AmBeed | 5g | 5063.17 Pln | |
| AmBeed | 10g | 7517.44 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(5-chloro-2-methoxy-4-methylphenyl)acetic acid (CAS 383134-15-4) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 2-(5-chloro-2-methoxy-4-methylphenyl)acetic acid. InChIKey: BRVGBLQVSPVSPO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 2-(5-chloro-2-methoxy-4-methylphenyl)acetic acid |
| InChIKey | BRVGBLQVSPVSPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)CC(=O)O)OC |
Computed by PubChem (NCBI)