CAS 383134-15-4 appears in our catalog under these names: (5-Chloro-2-methoxy-4-methylphenyl)acetic acid, 97%, 2-(5-Chloro-2-methoxy-4-methylphenyl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
2-(5-chloro-2-methoxy-4-methylphenyl)acetic acid (CAS 383134-15-4) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 2-(5-chloro-2-methoxy-4-methylphenyl)acetic acid. InChIKey: BRVGBLQVSPVSPO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 2-(5-chloro-2-methoxy-4-methylphenyl)acetic acid |
| InChIKey | BRVGBLQVSPVSPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)CC(=O)O)OC |
Computed by PubChem (NCBI)