cas: 1030832-38-2 — see every product listed under this CAS number, including other names
2-(5-Fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 1030832-38-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696346-5G |
| cas | 1030832-38-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 612.30 Pln | |
| Fluorochem | 10g | 1127.75 Pln | |
| Fluorochem | 25g | 2455.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(5-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1030832-38-2) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-(5-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZTKSYTPCVNDCIE-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-(5-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZTKSYTPCVNDCIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)C |
Computed by PubChem (NCBI)