cas: 1030832-38-2 — see every product listed under this CAS number, including other names
5-Fluoro-2-methylphenylboronic acid pinacol ester, 95%, 95% (CAS 1030832-38-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11017U-250mg |
| cas | 1030832-38-2 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 25g | 1605.20 Pln | |
| Chemat | 100g | 5555.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(5-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1030832-38-2) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-(5-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZTKSYTPCVNDCIE-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-(5-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZTKSYTPCVNDCIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)C |
Computed by PubChem (NCBI)