cas: 41340-36-7 — see every product listed under this CAS number, including other names
2-(7-Ethyl-1H-indol-3-yl)ethanol, 95% (CAS 41340-36-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221698-5G |
| cas | 41340-36-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 508.17 Pln | |
| Fluorochem | 250g | 1190.22 Pln | |
| Fluorochem | 500g | 1658.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(7-ethyl-1H-indol-3-yl)ethanol (CAS 41340-36-7) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 2-(7-ethyl-1H-indol-3-yl)ethanol. InChIKey: UVSDNCAZVSQJQA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 2-(7-ethyl-1H-indol-3-yl)ethanol |
| InChIKey | UVSDNCAZVSQJQA-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=CN2)CCO |
Computed by PubChem (NCBI)