cas: 41340-36-7 — see every product listed under this CAS number, including other names
2-(7-ethyl-1H-indol-3-yl)ethanol, 98%, 98% (CAS 41340-36-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 10g, 15g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140LO-5g |
| cas | 41340-36-7 |
| size | 5g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 448.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 15g | 136.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(7-ethyl-1H-indol-3-yl)ethanol (CAS 41340-36-7) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 2-(7-ethyl-1H-indol-3-yl)ethanol. InChIKey: UVSDNCAZVSQJQA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 2-(7-ethyl-1H-indol-3-yl)ethanol |
| InChIKey | UVSDNCAZVSQJQA-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=CN2)CCO |
Computed by PubChem (NCBI)