cas: 24644-08-4 — see every product listed under this CAS number, including other names
2-(Adamantan-1-yl)ethan-1-amine hydrochloride 97% (CAS 24644-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A616649-100mg |
| cas | 24644-08-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1282.62 Pln | |
| Ambeed | 5g | 5454.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A616649 |
2-(1-adamantyl)ethanamine;hydrochloride (CAS 24644-08-4) is a chemical compound with the molecular formula C12H22ClN and a molecular weight of 215.76 g/mol. IUPAC name: 2-(1-adamantyl)ethanamine;hydrochloride. InChIKey: GKRPMKRIQVEDAE-UHFFFAOYSA-N.
| Molecular formula | C12H22ClN |
|---|---|
| Molecular weight | 215.76 g/mol |
| IUPAC name | 2-(1-adamantyl)ethanamine;hydrochloride |
| InChIKey | GKRPMKRIQVEDAE-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CCN.Cl |
Computed by PubChem (NCBI)