CAS 1820580-25-3 is the registry number for Rac-(2s,6s)-2-allyl-6-butyl-1,2,3,6-tetrahydropyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2S,6S)-6-butyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine;hydrochloride (CAS 1820580-25-3) is a chemical compound with the molecular formula C12H22ClN and a molecular weight of 215.76 g/mol. IUPAC name: (2S,6S)-6-butyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine;hydrochloride. InChIKey: UAHYSJCZSZAOAC-FXMYHANSSA-N.
| Molecular formula | C12H22ClN |
|---|---|
| Molecular weight | 215.76 g/mol |
| IUPAC name | (2S,6S)-6-butyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine;hydrochloride |
| InChIKey | UAHYSJCZSZAOAC-FXMYHANSSA-N |
| SMILES | CCCC[C@H]1C=CC[C@@H](N1)CC=C.Cl |
Computed by PubChem (NCBI)