cas: 24644-08-4 — see every product listed under this CAS number, including other names
2-(adamantan-1-yl)ethan-1-amine hydrochloride, 97%, 97% (CAS 24644-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120I5O-100mg |
| cas | 24644-08-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1058.00 Pln | |
| Chemat | 5g | 4494.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(1-adamantyl)ethanamine;hydrochloride (CAS 24644-08-4) is a chemical compound with the molecular formula C12H22ClN and a molecular weight of 215.76 g/mol. IUPAC name: 2-(1-adamantyl)ethanamine;hydrochloride. InChIKey: GKRPMKRIQVEDAE-UHFFFAOYSA-N.
| Molecular formula | C12H22ClN |
|---|---|
| Molecular weight | 215.76 g/mol |
| IUPAC name | 2-(1-adamantyl)ethanamine;hydrochloride |
| InChIKey | GKRPMKRIQVEDAE-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CCN.Cl |
Computed by PubChem (NCBI)