cas: 892686-59-8 — see every product listed under this CAS number, including other names
2-(Benzo[d]thiazol-2-yl)-4,5,6,7-tetrahydro-2H-indazol-3-ol, 98%, 98% (CAS 892686-59-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KYP5-25mg |
| cas | 892686-59-8 |
| size | 25mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 515.60 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 500mg | 3083.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one (CAS 892686-59-8) is a chemical compound with the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one. InChIKey: QWUHPPCZZXKXOQ-UHFFFAOYSA-N.
| Molecular formula | C14H13N3OS |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one |
| InChIKey | QWUHPPCZZXKXOQ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N(N2)C3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)