cas: 892686-59-8 — see every product listed under this CAS number, including other names
BD750 (CAS 892686-59-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC60628-10 |
| cas | 892686-59-8 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 849.79 Pln | |
| GLPBio | 100mg | 2586.25 Pln | |
| GLPBio | 25mg | 1196.14 Pln | |
| GLPBio | 5mg | 676.61 Pln | |
| GLPBio | 50mg | 1715.68 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one (CAS 892686-59-8) is a chemical compound with the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one. InChIKey: QWUHPPCZZXKXOQ-UHFFFAOYSA-N.
| Molecular formula | C14H13N3OS |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one |
| InChIKey | QWUHPPCZZXKXOQ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N(N2)C3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)