cas: 1020957-75-8 — see every product listed under this CAS number, including other names
2-(Benzyl(methyl)amino)benzaldehyde, 97% (CAS 1020957-75-8) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F721865-500MG |
| cas | 1020957-75-8 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1174.60 Pln | |
| Fluorochem | 1g | 1695.25 Pln | |
| Fluorochem | 5g | 4918.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[benzyl(methyl)amino]benzaldehyde (CAS 1020957-75-8) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 2-[benzyl(methyl)amino]benzaldehyde. InChIKey: OQKNKCGZXXLERS-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 2-[benzyl(methyl)amino]benzaldehyde |
| InChIKey | OQKNKCGZXXLERS-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)