cas: 120980-85-0 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-3-bromobenzaldehyde, 97% (CAS 120980-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608722-100MG |
| cas | 120980-85-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1820.21 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-2-phenylmethoxybenzaldehyde (CAS 120980-85-0) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: 3-bromo-2-phenylmethoxybenzaldehyde. InChIKey: WXCPOOYYSDHTPQ-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 3-bromo-2-phenylmethoxybenzaldehyde |
| InChIKey | WXCPOOYYSDHTPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2Br)C=O |
Computed by PubChem (NCBI)