Products 84244-98-4
CAS 84244-98-4 appears in our catalog under these names: 4-Acetoxy-4'-bromobiphenyl, 4-Acetoxy-4'-bromobiphenyl, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[4-(4-bromophenyl)phenyl] acetate (CAS 84244-98-4) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: [4-(4-bromophenyl)phenyl] acetate. InChIKey: PZPSICDSQWAIBR-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | [4-(4-bromophenyl)phenyl] acetate |
| InChIKey | PZPSICDSQWAIBR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)
Synonyms:
4'-Bromo-[1,1'-biphenyl]-4-ol acetate, 4'-Bromo-(1,1'-biphenyl)-4-ol acetate, 4-Acetoxy-4'-bromobiphenyl, [4-(4-bromophenyl)phenyl] acetate, 4'-Bromo-[1,1'-biphenyl]-4-yl acetate, 4-(4-bromophenyl)phenyl acetate, 4-Acetoxy-4''-bromobiphenyl, PZPSICDSQWAIBR-UHFFFAOYSA-N, 4'-Bromo-[1,1'-biphenyl]-4-ylacetate, 4'-Bromo[1,1'-biphenyl]-4-yl acetate