Products 1215206-43-1

CAS 1215206-43-1 is the registry number for 2'-Bromo-5'-methylbiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(2-bromo-5-methylphenyl)benzoic acid (CAS 1215206-43-1) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: 3-(2-bromo-5-methylphenyl)benzoic acid. InChIKey: ARBCCNREKATMRE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BrO2
Molecular weight291.14 g/mol
IUPAC name3-(2-bromo-5-methylphenyl)benzoic acid
InChIKeyARBCCNREKATMRE-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)Br)C2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)