cas: 849210-10-2 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-4-bromo-1-nitrobenzene 98% (CAS 849210-10-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A709395-100mg |
| cas | 849210-10-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A709395 |
4-bromo-1-nitro-2-phenylmethoxybenzene (CAS 849210-10-2) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 4-bromo-1-nitro-2-phenylmethoxybenzene. InChIKey: ISIBNKKIJOEHIW-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 4-bromo-1-nitro-2-phenylmethoxybenzene |
| InChIKey | ISIBNKKIJOEHIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)