cas: 159624-15-4 — see every product listed under this CAS number, including other names
2-(Boc-amino)phenylboronic Acid Pinacol Ester 98% (CAS 159624-15-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A227968-250mg |
| cas | 159624-15-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A227968 |
Tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 159624-15-4) is a chemical compound with the molecular formula C17H26BNO4 and a molecular weight of 319.2 g/mol. IUPAC name: tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: LVHGGVGVAUJQBB-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | LVHGGVGVAUJQBB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)