CAS 1351379-27-5 is the registry number for 4-(3-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)morpholine, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine (CAS 1351379-27-5) is a chemical compound with the molecular formula C17H26BNO4 and a molecular weight of 319.2 g/mol. IUPAC name: 4-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine. InChIKey: DXACXPSIDHEAJP-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 4-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine |
| InChIKey | DXACXPSIDHEAJP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC)N3CCOCC3 |
Computed by PubChem (NCBI)