CAS 1509932-25-5 is the registry number for N-(3-methoxypropyl)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-(3-methoxypropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1509932-25-5) is a chemical compound with the molecular formula C17H26BNO4 and a molecular weight of 319.2 g/mol. IUPAC name: N-(3-methoxypropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: YDQWOIRDNLVORD-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | N-(3-methoxypropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | YDQWOIRDNLVORD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NCCCOC |
Computed by PubChem (NCBI)