cas: 1958-93-6 — see every product listed under this CAS number, including other names
2-(Bromomethyl)-1-fluoro-3-nitrobenzene, 97% (CAS 1958-93-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241106-250MG |
| cas | 1958-93-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 378.01 Pln | |
| Fluorochem | 10g | 695.61 Pln | |
| Fluorochem | 25g | 1653.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(bromomethyl)-1-fluoro-3-nitrobenzene (CAS 1958-93-6) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-(bromomethyl)-1-fluoro-3-nitrobenzene. InChIKey: KKSODTKRSQTJFZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-(bromomethyl)-1-fluoro-3-nitrobenzene |
| InChIKey | KKSODTKRSQTJFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)