CAS 1036756-03-2 appears in our catalog under these names: 6-Amino-3-bromo-2-fluorobenzoic acid, 6-Amino-3-bromo-2-fluorobenzoic acid, 95%, 6-Amino-3-bromo-2-fluorobenzoic acid 97%, 6-AMINO-3-BROMO-2-FLUOROBENZOIC ACID, 96%, 6-Amino-3-Bromo-2-Fluorobenzoic Acid, 96%, 96%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 50g, 5g, 1g, 25g, 100g, 500g, 10g, 250mg.
6-amino-3-bromo-2-fluorobenzoic acid (CAS 1036756-03-2) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 6-amino-3-bromo-2-fluorobenzoic acid. InChIKey: NUEJVMJQKLRHCO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 6-amino-3-bromo-2-fluorobenzoic acid |
| InChIKey | NUEJVMJQKLRHCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)F)Br |
Computed by PubChem (NCBI)