CAS 1339056-03-9 is the registry number for 3-Amino-5-bromo-2-fluorobenzoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-amino-5-bromo-2-fluorobenzoic acid (CAS 1339056-03-9) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 3-amino-5-bromo-2-fluorobenzoic acid. InChIKey: MRTOTKCKUHHOLC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 3-amino-5-bromo-2-fluorobenzoic acid |
| InChIKey | MRTOTKCKUHHOLC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)N)Br |
Computed by PubChem (NCBI)