Products 1339056-03-9

CAS 1339056-03-9 is the registry number for 3-Amino-5-bromo-2-fluorobenzoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-amino-5-bromo-2-fluorobenzoic acid (CAS 1339056-03-9) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 3-amino-5-bromo-2-fluorobenzoic acid. InChIKey: MRTOTKCKUHHOLC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrFNO2
Molecular weight234.02 g/mol
IUPAC name3-amino-5-bromo-2-fluorobenzoic acid
InChIKeyMRTOTKCKUHHOLC-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)F)N)Br

Computed by PubChem (NCBI)