cas: 324779-96-6 — see every product listed under this CAS number, including other names
2-(Cinnamylthio)nicotinic acid, 95%, 95% (CAS 324779-96-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C712-100mg |
| cas | 324779-96-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 832.40 Pln | |
| Chemat | 5g | 2627.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(E)-3-phenylprop-2-enyl]sulfanylpyridine-3-carboxylic acid (CAS 324779-96-6) is a chemical compound with the molecular formula C15H13NO2S and a molecular weight of 271.3 g/mol. IUPAC name: 2-[(E)-3-phenylprop-2-enyl]sulfanylpyridine-3-carboxylic acid. InChIKey: QJXFXWNDLUHFEU-VMPITWQZSA-N.
| Molecular formula | C15H13NO2S |
|---|---|
| Molecular weight | 271.3 g/mol |
| IUPAC name | 2-[(E)-3-phenylprop-2-enyl]sulfanylpyridine-3-carboxylic acid |
| InChIKey | QJXFXWNDLUHFEU-VMPITWQZSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/CSC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)