CAS 36635-66-2 appears in our catalog under these names: (1-Phenyl-1-tosyl)methyl isocyanide, 98%, α–(p–Toluenesulfonyl)benzyl Isocyanide, alpha-(p-Toluenesulfonyl)benzyl Isocyanide, >98.0%(HPLC)(N), Benzene, 1-[(isocyanophenylmethyl)sulfonyl]-4-methyl-, 98%, 98%, alpha-Tosylbenzyl isocyanide, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 100g.
1-[isocyano(phenyl)methyl]sulfonyl-4-methylbenzene (CAS 36635-66-2) is a chemical compound with the molecular formula C15H13NO2S and a molecular weight of 271.3 g/mol. IUPAC name: 1-[isocyano(phenyl)methyl]sulfonyl-4-methylbenzene. InChIKey: KIJCBVOPJSHLBI-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2S |
|---|---|
| Molecular weight | 271.3 g/mol |
| IUPAC name | 1-[isocyano(phenyl)methyl]sulfonyl-4-methylbenzene |
| InChIKey | KIJCBVOPJSHLBI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=CC=C2)[N+]#[C-] |
Computed by PubChem (NCBI)