CAS 324779-96-6 appears in our catalog under these names: 2-([(2E)-3-Phenylprop-2-en-1-yl]thio)nicotinic acid, 95%, 2-(Cinnamylthio)nicotinic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-[(E)-3-phenylprop-2-enyl]sulfanylpyridine-3-carboxylic acid (CAS 324779-96-6) is a chemical compound with the molecular formula C15H13NO2S and a molecular weight of 271.3 g/mol. IUPAC name: 2-[(E)-3-phenylprop-2-enyl]sulfanylpyridine-3-carboxylic acid. InChIKey: QJXFXWNDLUHFEU-VMPITWQZSA-N.
| Molecular formula | C15H13NO2S |
|---|---|
| Molecular weight | 271.3 g/mol |
| IUPAC name | 2-[(E)-3-phenylprop-2-enyl]sulfanylpyridine-3-carboxylic acid |
| InChIKey | QJXFXWNDLUHFEU-VMPITWQZSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/CSC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)