CAS 135191-75-2 appears in our catalog under these names: 2–(Cuban–1–yl)acetic acid, 2-(Cuban-1-yl)acetic acid, 95%, 2-(Cuban-1-yl)acetic acid, 98%, 98%, 2-((2R,3R,5R,6R,7R,8R)-Cuban-1-yl)acetic acid. Offered by: GLPBio, Combi-blocks, Chemat, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 25mg, 0,5g, 50mg.
2-cuban-1-ylacetic acid (CAS 135191-75-2) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: 2-cuban-1-ylacetic acid. InChIKey: GUEONBQYTUWHRR-UHFFFAOYSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | 2-cuban-1-ylacetic acid |
| InChIKey | GUEONBQYTUWHRR-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)C12C3C4C1C5C4C3C25 |
Computed by PubChem (NCBI)