CAS 50715-49-6 is the registry number for benzyl (R)-4-amino-3-((tert-butoxycarbonyl)amino)-4-oxobutanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-cuban-1-ylacetic acid (CAS 50715-49-6) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: 2-cuban-1-ylacetic acid. InChIKey: GUEONBQYTUWHRR-UHFFFAOYSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | 2-cuban-1-ylacetic acid |
| InChIKey | GUEONBQYTUWHRR-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)C12C3C4C1C5C4C3C25 |
Computed by PubChem (NCBI)