cas: 287944-13-2 — see every product listed under this CAS number, including other names
2-(Cyclohept-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 287944-13-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WIO-100mg |
| cas | 287944-13-2 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 3472.40 Pln | |
| Chemat | 25g | 11320.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(cyclohepten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 287944-13-2) is a chemical compound with the molecular formula C13H23BO2 and a molecular weight of 222.13 g/mol. IUPAC name: 2-(cyclohepten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XCKJXFSLFZYWSB-UHFFFAOYSA-N.
| Molecular formula | C13H23BO2 |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 2-(cyclohepten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XCKJXFSLFZYWSB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCCC2 |
Computed by PubChem (NCBI)