CAS 287944-13-2 appears in our catalog under these names: 1-Cycloheptenylboronic acid pinacol ester, 96%, 1-Cycloheptenylboronic acid pinacol ester, 95-<97%, 1-Cycloheptenylboronic acid pinacol ester, ≥97-<99%, 2-(Cyclohept-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(Cyclohept-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 2,5g, 10g, 25g, 50g, 100mg, 250mg.
2-(cyclohepten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 287944-13-2) is a chemical compound with the molecular formula C13H23BO2 and a molecular weight of 222.13 g/mol. IUPAC name: 2-(cyclohepten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XCKJXFSLFZYWSB-UHFFFAOYSA-N.
| Molecular formula | C13H23BO2 |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 2-(cyclohepten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XCKJXFSLFZYWSB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCCC2 |
Computed by PubChem (NCBI)