CAS 865869-26-7 appears in our catalog under these names: 4-Methyl-1-cyclohexene-1-boronic acid pinacol ester, 95%, 4-Methylcyclohexene-1-boronic acid pinacol ester, 95-<97%, 4-Methylcyclohexene-1-boronic acid pinacol ester, ≥97-<99%, 4-Methyl-1-cyclohexene-1-boronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(4-methyl-1-cyclohexen-1-yl)-1,3,2-dioxaborolane 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 50g, 100g, 200g, 100mg.
4,4,5,5-tetramethyl-2-(4-methylcyclohexen-1-yl)-1,3,2-dioxaborolane (CAS 865869-26-7) is a chemical compound with the molecular formula C13H23BO2 and a molecular weight of 222.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methylcyclohexen-1-yl)-1,3,2-dioxaborolane. InChIKey: SVHPQFUXPUDKLE-UHFFFAOYSA-N.
| Molecular formula | C13H23BO2 |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methylcyclohexen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | SVHPQFUXPUDKLE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)C |
Computed by PubChem (NCBI)