cas: 97963-50-3 — see every product listed under this CAS number, including other names
2-(Difluoromethoxy)-1-fluoro-4-nitrobenzene, 98% (CAS 97963-50-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A271039-10g |
| cas | 97963-50-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 7178.92 Pln | |
| AmBeed | 25g | 14287.84 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(difluoromethoxy)-1-fluoro-4-nitrobenzene (CAS 97963-50-3) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 2-(difluoromethoxy)-1-fluoro-4-nitrobenzene. InChIKey: UKSAGCUNNXEOBJ-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 2-(difluoromethoxy)-1-fluoro-4-nitrobenzene |
| InChIKey | UKSAGCUNNXEOBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])OC(F)F)F |
Computed by PubChem (NCBI)