cas: 1261839-70-6 — see every product listed under this CAS number, including other names
2-(Difluoromethoxy)-6-fluoroaniline 97% (CAS 1261839-70-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A907165-100mg |
| cas | 1261839-70-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1282.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A907165 |
2-(difluoromethoxy)-6-fluoroaniline (CAS 1261839-70-6) is a chemical compound with the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. IUPAC name: 2-(difluoromethoxy)-6-fluoroaniline. InChIKey: CNOGNJAHRMWUCO-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | 2-(difluoromethoxy)-6-fluoroaniline |
| InChIKey | CNOGNJAHRMWUCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N)OC(F)F |
Computed by PubChem (NCBI)