cas: 1261839-70-6 — see every product listed under this CAS number, including other names
2-(Difluoromethoxy)-6-fluoroaniline, 97%, 97% (CAS 1261839-70-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FHCV-100mg |
| cas | 1261839-70-6 |
| size | 100mg |
| availability | 1.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 395.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(difluoromethoxy)-6-fluoroaniline (CAS 1261839-70-6) is a chemical compound with the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. IUPAC name: 2-(difluoromethoxy)-6-fluoroaniline. InChIKey: CNOGNJAHRMWUCO-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | 2-(difluoromethoxy)-6-fluoroaniline |
| InChIKey | CNOGNJAHRMWUCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N)OC(F)F |
Computed by PubChem (NCBI)