cas: 24268-81-3 — see every product listed under this CAS number, including other names
2-(Dimethylamino)-3-phenylpropanoic acid (CAS 24268-81-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | ZAA26881-5g |
| cas | 24268-81-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Fluorochem | 100mg | 1591.12 Pln | |
| Fluorochem | 250mg | 3106.22 Pln | |
| Fluorochem | 500mg | 3611.25 Pln | |
| Fluorochem | 1g | 5136.75 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
2-(dimethylamino)-3-phenylpropanoic acid (CAS 24268-81-3) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-(dimethylamino)-3-phenylpropanoic acid. InChIKey: HOGIQTACRLIOHC-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-(dimethylamino)-3-phenylpropanoic acid |
| InChIKey | HOGIQTACRLIOHC-UHFFFAOYSA-N |
| SMILES | CN(C)C(CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)