2-(Methylsulfonyl)naphthalene, 95%
cas: 35330-75-7 — see every product listed under this CAS number, including other names
2-(Methylsulfonyl)naphthalene, 95% (CAS 35330-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A800542-250mg |
| cas | 35330-75-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 3018.12 Pln | |
| BLDpharm | 100mg | 764.20 Pln | |
| BLDpharm | 250mg | 1225.15 Pln | |
| BLDpharm | 1g | 3246.66 Pln | |
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 866.00 Pln | |
| Chemat | 1g | 2229.20 Pln | |
| Fluorochem | 100mg | 732.05 Pln | |
| Fluorochem | 250mg | 1174.60 Pln | |
| Fluorochem | 1g | 3111.42 Pln | |
| Fluorochem | 5g | 11165.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-methylsulfonylnaphthalene (CAS 35330-75-7) is a chemical compound with the molecular formula C11H10O2S and a molecular weight of 206.26 g/mol. IUPAC name: 2-methylsulfonylnaphthalene. InChIKey: BNRKPIUZQHYIAL-UHFFFAOYSA-N.
| Molecular formula | C11H10O2S |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 2-methylsulfonylnaphthalene |
| InChIKey | BNRKPIUZQHYIAL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)