CAS 54108-51-9 is the registry number for 1-Methanesulfonyl-naphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
1-methylsulfonylnaphthalene (CAS 54108-51-9) is a chemical compound with the molecular formula C11H10O2S and a molecular weight of 206.26 g/mol. IUPAC name: 1-methylsulfonylnaphthalene. InChIKey: RJDVUMLFYFNKEW-UHFFFAOYSA-N.
| Molecular formula | C11H10O2S |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 1-methylsulfonylnaphthalene |
| InChIKey | RJDVUMLFYFNKEW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)