Products 26461-80-3
CAS 26461-80-3 appears in our catalog under these names: 3-(1-Benzothiophen-3-yl)propanoic acid, 98%, 3-(Benzo(b)thiophen-3-yl)propanoic acid, 97%, 3-(1-Benzothiophen-3-yl)propanoic acid, 98%, 98%. Offered by: Fluorochem, AmBeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
3-(1-benzothiophen-3-yl)propanoic acid (CAS 26461-80-3) is a chemical compound with the molecular formula C11H10O2S and a molecular weight of 206.26 g/mol. IUPAC name: 3-(1-benzothiophen-3-yl)propanoic acid. InChIKey: GTCFFWIYYOTHRS-UHFFFAOYSA-N.
| Molecular formula | C11H10O2S |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | 3-(1-benzothiophen-3-yl)propanoic acid |
| InChIKey | GTCFFWIYYOTHRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)CCC(=O)O |
Computed by PubChem (NCBI)