cas: 178432-25-2 — see every product listed under this CAS number, including other names
2-(N,N-Dimethylsulphamoyl)benzeneboronic Acid 98% (CAS 178432-25-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A655659-250mg |
| cas | 178432-25-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A655659 |
[2-(dimethylsulfamoyl)phenyl]boronic acid (CAS 178432-25-2) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: [2-(dimethylsulfamoyl)phenyl]boronic acid. InChIKey: GCHDOHKUPJUTCB-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4S |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | [2-(dimethylsulfamoyl)phenyl]boronic acid |
| InChIKey | GCHDOHKUPJUTCB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1S(=O)(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)