cas: 38752-48-6 — see every product listed under this CAS number, including other names
2-(Phenylsulfonyl)ethanamine hydrochloride 98% (CAS 38752-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A852694-100mg |
| cas | 38752-48-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1377.19 Pln | |
| Ambeed | 5g | 4981.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A852694 |
2-(benzenesulfonyl)ethanamine;hydrochloride (CAS 38752-48-6) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: 2-(benzenesulfonyl)ethanamine;hydrochloride. InChIKey: HSFNBRHAUKLROY-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | 2-(benzenesulfonyl)ethanamine;hydrochloride |
| InChIKey | HSFNBRHAUKLROY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCN.Cl |
Computed by PubChem (NCBI)