cas: 38752-48-6 — see every product listed under this CAS number, including other names
2-(Phenylsulfonyl)ethanamine Hydrochloride, 98%, 98% (CAS 38752-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8OO-100mg |
| cas | 38752-48-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 333.20 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1058.00 Pln | |
| Chemat | 5g | 3357.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(benzenesulfonyl)ethanamine;hydrochloride (CAS 38752-48-6) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: 2-(benzenesulfonyl)ethanamine;hydrochloride. InChIKey: HSFNBRHAUKLROY-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | 2-(benzenesulfonyl)ethanamine;hydrochloride |
| InChIKey | HSFNBRHAUKLROY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCN.Cl |
Computed by PubChem (NCBI)