CAS 38752-48-6 appears in our catalog under these names: 2-(Benzenesulfonyl)ethan-1-amine hydrochloride, 95%, 2-(Phenylsulfonyl)ethanamine hydrochloride 98%, 2-(Phenylsulfonyl)ethanamine Hydrochloride, 98%, 98%, 2-AMINOETHYLPHENYLSULFONE HCL, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg, 500mg, 2.5g.
2-(benzenesulfonyl)ethanamine;hydrochloride (CAS 38752-48-6) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: 2-(benzenesulfonyl)ethanamine;hydrochloride. InChIKey: HSFNBRHAUKLROY-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | 2-(benzenesulfonyl)ethanamine;hydrochloride |
| InChIKey | HSFNBRHAUKLROY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCN.Cl |
Computed by PubChem (NCBI)