cas: 29528-30-1 — see every product listed under this CAS number, including other names
2-(Pyridin-2-Yl)Aniline, 96%, 96% (CAS 29528-30-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113YMY-100mg |
| cas | 29528-30-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 5g | 3054.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-pyridin-2-ylaniline (CAS 29528-30-1) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 2-pyridin-2-ylaniline. InChIKey: VPZCNNNHCMBJCM-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-pyridin-2-ylaniline |
| InChIKey | VPZCNNNHCMBJCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=N2)N |
Computed by PubChem (NCBI)