CAS 28217-95-0 appears in our catalog under these names: 2-Benzylpyrazine, 95%, 95%, 2-Benzylpyrazine, 95%, 2-Benzylpyrazine 95%, 2–Benzylpyrazine. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-benzylpyrazine (CAS 28217-95-0) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 2-benzylpyrazine. InChIKey: QGSOPZAYKHDVDO-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-benzylpyrazine |
| InChIKey | QGSOPZAYKHDVDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC=CN=C2 |
Computed by PubChem (NCBI)