CAS 29528-30-1 appears in our catalog under these names: 2-(2-Pyridyl)aniline, 97%, 2-(Pyridin-2-yl)aniline 96%, 2-(Pyridin-2-Yl)Aniline, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-pyridin-2-ylaniline (CAS 29528-30-1) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 2-pyridin-2-ylaniline. InChIKey: VPZCNNNHCMBJCM-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-pyridin-2-ylaniline |
| InChIKey | VPZCNNNHCMBJCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=N2)N |
Computed by PubChem (NCBI)